ChemNet > CAS > 5714-73-8 N-benzoylglycine, compound with 1,3,5,7-tetraazatricyclo[3.3.1.13,7]decane (1:1)
5714-73-8 N-benzoylglycine, compound with 1,3,5,7-tetraazatricyclo[3.3.1.13,7]decane (1:1)
Naam product |
N-benzoylglycine, compound with 1,3,5,7-tetraazatricyclo[3.3.1.13,7]decane (1:1) |
Engelse naam |
N-benzoylglycine, compound with 1,3,5,7-tetraazatricyclo[3.3.1.13,7]decane (1:1); Methenamine Hippurate; N-benzoylglycine - 1,3,5,7-tetraazatricyclo[3.3.1.1~3,7~]decane (1:1) |
MF |
C15H21N5O3 |
Molecuulgewicht |
319.3589 |
InChI |
InChI=1/C9H9NO3.C6H12N4/c11-8(12)6-10-9(13)7-4-2-1-3-5-7;1-7-2-9-4-8(1)5-10(3-7)6-9/h1-5H,6H2,(H,10,13)(H,11,12);1-6H2 |
CAS-nummer |
5714-73-8 |
EINECS |
227-206-5 |
Moleculaire Structuur |
|
Kookpunt |
464.1°C at 760 mmHg |
Vlampunt |
234.5°C |
Dampdruk |
2.06E-09mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
|
|